Amino PEG

Amino PEG


Amino PEG, PEG amine is a class of PEG linkers containing an amino group which can react with acids, succinimidyl-active esters (NHS ester) or pentafluorophenyl (PFP) esters for labeling, chemical modification, surface or particle modifications.

Catalog Product Name Structure M.W. Purity Pricing
Amino-PEG-acid
BP-20687Amino-PEG1-acidMolecular structure of the compound: Amino-PEG1-acid133.198%Pricing
BP-20523Amino-PEG2-acidMolecular structure of the compound: Amino-PEG2-acid177.298%Pricing
BP-21588Amino-PEG3-acidMolecular structure of the compound: Amino-PEG3-acid221.398%Pricing
BP-20423Amino-PEG4-acidMolecular structure of the compound: Amino-PEG4-acid265.398%Pricing
BP-21697Amino-PEG5-acidMolecular structure of the compound: Amino-PEG5-acid309.498%Pricing
BP-20424Amino-PEG6-acidMolecular structure of the compound: Amino-PEG6-acid353.498%Pricing
BP-21113Amino-PEG8-acidMolecular structure of the compound: Amino-PEG8-acid441.597%Pricing
BP-21822Amino-PEG9-acidMolecular structure of the compound: Amino-PEG9-acid484.698%Pricing
BP-21818Amino-PEG10-acidMolecular structure of the compound: Amino-PEG10-acid529.698%Pricing
BP-21114Amino-PEG12-acidMolecular structure of the compound: Amino-PEG12-acid617.798%Pricing
BP-21880Amino-PEG16-acidMolecular structure of the compound: Amino-PEG16-acid794.098%Pricing
BP-21919Amino-PEG20-acid HCl saltMolecular structure of the compound: Amino-PEG20-acid HCl salt970.298%Pricing
BP-23363Amino-PEG23-acid HCl saltMolecular structure of the compound: Amino-PEG23-acid HCl salt1102.396%Pricing
BP-21910Amino-PEG24-acidMolecular structure of the compound: Amino-PEG24-acid1146.497%Pricing
BP-23358Amino-PEG25-acid HCl saltMolecular structure of the compound: Amino-PEG25-acid HCl salt1190.498%Pricing
BP-23381Amino-PEG32-acidMolecular structure of the compound: Amino-PEG32-acid1498.895%Pricing
BP-22577Amino-PEG36-acidMolecular structure of the compound: Amino-PEG36-acid1675.097%Pricing
BP-24009Amino-PEG36-CONH-PEG36-acidMolecular structure of the compound: Amino-PEG36-CONH-PEG36-acid3332.098%Pricing
BP-2439017-(Amino-PEG6-ethylcarbamoyl)heptadecanoic acid TFA saltMolecular structure of the compound: 17-(Amino-PEG6-ethylcarbamoyl)heptadecanoic acid TFA salt620.9Pricing
Amino-PEG-CH2CO2H
BP-22592Amino-PEG2-CH2CO2HMolecular structure of the compound: Amino-PEG2-CH2CO2H163.298%Pricing
BP-22098Amino-PEG4-CH2CO2HMolecular structure of the compound: Amino-PEG4-CH2CO2H251.398%Pricing
Amino-PEG-t-butyl ester
BP-20679Amino-PEG1-t-butyl esterMolecular structure of the compound: Amino-PEG1-t-butyl ester189.398%Pricing
BP-20555Amino-PEG2-t-butyl esterMolecular structure of the compound: Amino-PEG2-t-butyl ester233.398%Pricing
BP-20697Amino-PEG3-t-butyl esterMolecular structure of the compound: Amino-PEG3-t-butyl ester277.498%Pricing
BP-20419Amino-PEG4-t-butyl esterMolecular structure of the compound: Amino-PEG4-t-butyl ester321.498%Pricing
BP-21698Amino-PEG5-t-butyl esterMolecular structure of the compound: Amino-PEG5-t-butyl ester365.598%Pricing
BP-20420Amino-PEG6-t-butyl esterMolecular structure of the compound: Amino-PEG6-t-butyl ester409.598%Pricing
BP-21119Amino-PEG8-t-butyl esterMolecular structure of the compound: Amino-PEG8-t-butyl ester497.698%Pricing
BP-21824Amino-PEG9-t-butyl esterMolecular structure of the compound: Amino-PEG9-t-butyl ester541.798%Pricing
BP-21819Amino-PEG10-t-butyl esterMolecular structure of the compound: Amino-PEG10-t-butyl ester585.798%Pricing
BP-25641Amino-PEG11-t-butyl esterMolecular structure of the compound: Amino-PEG11-t-butyl ester629.898%Pricing
BP-21500Amino-PEG12-t-butyl esterMolecular structure of the compound: Amino-PEG12-t-butyl ester673.898%Pricing
BP-24316Amino-PEG20-t-butyl esterMolecular structure of the compound: Amino-PEG20-t-butyl ester1026.398%Pricing
BP-21920Amino-PEG24-t-butyl esterMolecular structure of the compound: Amino-PEG24-t-butyl ester1202.597%Pricing
BP-21921Amino-PEG36-t-butyl esterMolecular structure of the compound: Amino-PEG36-t-butyl ester1731.195%Pricing
BP-2437017-(Amino-PEG6-ethylcarbamoyl)heptadecanoic t-butyl esterMolecular structure of the compound: 17-(Amino-PEG6-ethylcarbamoyl)heptadecanoic t-butyl ester677.097%Pricing
BP-244269-(Amino-PEG9-ethylcarbamoyl)nonanoic t-butyl esterMolecular structure of the compound: 9-(Amino-PEG9-ethylcarbamoyl)nonanoic t-butyl ester696.997%Pricing
BP-2437117-(Amino-PEG9-ethylcarbamoyl)heptadecanoic t-butyl esterMolecular structure of the compound: 17-(Amino-PEG9-ethylcarbamoyl)heptadecanoic t-butyl ester809.195%Pricing
Amino-PEG-CH2CO2-t-butyl ester
BP-23620Amino-PEG3-CH2CO2-t-butyl esterMolecular structure of the compound: Amino-PEG3-CH2CO2-t-butyl ester263.398%Pricing
BP-25109Amino-PEG12-CH2CO2-t-butyl esterMolecular structure of the compound: Amino-PEG12-CH2CO2-t-butyl ester659.898%Pricing
Amino-PEG-alcohol
BP-23664Amino-PEG2-alcoholMolecular structure of the compound: Amino-PEG2-alcohol105.198%Pricing
BP-20694Amino-PEG3-alcoholMolecular structure of the compound: Amino-PEG3-alcohol149.298%Pricing
BP-20589Amino-PEG4-alcoholMolecular structure of the compound: Amino-PEG4-alcohol193.298%Pricing
BP-22355Amino-PEG5-alcoholMolecular structure of the compound: Amino-PEG5-alcohol237.398%Pricing
BP-20659Amino-PEG6-alcoholMolecular structure of the compound: Amino-PEG6-alcohol281.498%Pricing
BP-22589Amino-PEG7-alcoholMolecular structure of the compound: Amino-PEG7-alcohol325.498%Pricing
BP-21502Amino-PEG8-alcoholMolecular structure of the compound: Amino-PEG8-alcohol369.598%Pricing
BP-24084Amino-PEG9-alcoholMolecular structure of the compound: Amino-PEG9-alcohol413.598%Pricing
BP-22590Amino-PEG10-alcoholMolecular structure of the compound: Amino-PEG10-alcohol457.698%Pricing
BP-23798Amino-PEG11-alcoholMolecular structure of the compound: Amino-PEG11-alcohol501.698%Pricing
BP-21503Amino-PEG12-alcoholMolecular structure of the compound: Amino-PEG12-alcohol545.798%Pricing
BP-21924Amino-PEG24-alcoholMolecular structure of the compound: Amino-PEG24-alcohol1074.397%Pricing
BP-21925Amino-PEG36-alcoholMolecular structure of the compound: Amino-PEG36-alcohol1603.097%Pricing
Amino-PEG-Amine
BP-23107Amino-PEG1-amineMolecular structure of the compound: Amino-PEG1-amine104.298%Pricing
BP-20404Amino-PEG2-amineMolecular structure of the compound: Amino-PEG2-amine148.298%Pricing
BP-20571Amino-PEG3-amineMolecular structure of the compound: Amino-PEG3-amine192.398%Pricing
BP-21684Amino-PEG4-amineMolecular structure of the compound: Amino-PEG4-amine236.398%Pricing
BP-20326Amino-PEG5-amineMolecular structure of the compound: Amino-PEG5-amine280.498%Pricing
BP-23486Amino-PEG6-amineMolecular structure of the compound: Amino-PEG6-amine324.497%Pricing
BP-22586Amino-PEG7-amineMolecular structure of the compound: Amino-PEG7-amine368.598%Pricing
BP-22251Amino-PEG8-amineMolecular structure of the compound: Amino-PEG8-amine412.598%Pricing
BP-22252Amino-PEG9-amineMolecular structure of the compound: Amino-PEG9-amine456.698%Pricing
BP-22253Amino-PEG10-amineMolecular structure of the compound: Amino-PEG10-amine500.698%Pricing
BP-22254Amino-PEG11-amineMolecular structure of the compound: Amino-PEG11-amine544.798%Pricing
BP-28067Amino-PEG19-amineMolecular structure of the compound: Amino-PEG19-amine897.198%Pricing
BP-23880Amino-PEG23-amineMolecular structure of the compound: Amino-PEG23-amine1073.395%Pricing
BP-257204,7,10,13,16-Pentaoxanonadecane-1,19-diamineMolecular structure of the compound: 4,7,10,13,16-Pentaoxanonadecane-1,19-diamine308.4Pricing
BP-27841PEG8-bis(C3-amine)Molecular structure of the compound: PEG8-bis(C3-amine)440.6Pricing
Amino-PEG-azide
BP-21611Azido-PEG1-amineMolecular structure of the compound: Azido-PEG1-amine130.298%Pricing
BP-20692Azido-PEG2-amineMolecular structure of the compound: Azido-PEG2-amine174.298%Pricing
BP-20580Azido-PEG3-amineMolecular structure of the compound: Azido-PEG3-amine218.398%Pricing
BP-21615Azido-PEG4-amineMolecular structure of the compound: Azido-PEG4-amine262.398%Pricing
BP-20590Azido-PEG5-amineMolecular structure of the compound: Azido-PEG5-amine306.498%Pricing
BP-22224Azido-PEG6-amineMolecular structure of the compound: Azido-PEG6-amine350.498%Pricing
BP-21507Azido-PEG7-amineMolecular structure of the compound: Azido-PEG7-amine394.598%Pricing
BP-22225Azido-PEG8-amineMolecular structure of the compound: Azido-PEG8-amine438.598%Pricing
BP-23556Azido-PEG9-amineMolecular structure of the compound: Azido-PEG9-amine482.698%Pricing
BP-22226Azido-PEG10-amineMolecular structure of the compound: Azido-PEG10-amine526.698%Pricing
BP-22227Azido-PEG11-amineMolecular structure of the compound: Azido-PEG11-amine570.798%Pricing
BP-21956Azido-PEG23 amineMolecular structure of the compound: Azido-PEG23 amine1099.397%Pricing
BP-21957Azido-PEG35 amineMolecular structure of the compound: Azido-PEG35 amine1628.097%Pricing
Amino-PEG-sulfonic acid
BP-22925Amino-PEG3-sulfonic acid HCl saltMolecular structure of the compound: Amino-PEG3-sulfonic acid HCl salt257.398%Pricing
Amino-PEG-t-Boc-Hydrazide
BP-23677Amino-PEG2-t-Boc-hydrazideMolecular structure of the compound: Amino-PEG2-t-Boc-hydrazide291.498%Pricing
BP-21616Amino-PEG4-t-Boc-hydrazideMolecular structure of the compound: Amino-PEG4-t-Boc-hydrazide379.598%Pricing
BP-21617Amino-PEG8-t-Boc-hydrazideMolecular structure of the compound: Amino-PEG8-t-Boc-hydrazide555.798%Pricing
m-PEG-amine
BP-21109m-PEG2-amineMolecular structure of the compound: m-PEG2-amine119.298%Pricing
BP-20975m-PEG3-amineMolecular structure of the compound: m-PEG3-amine163.298%Pricing
BP-21110m-PEG4-amineMolecular structure of the compound: m-PEG4-amine207.398%Pricing
BP-22075m-PEG5-amineMolecular structure of the compound: m-PEG5-amine251.398%Pricing
BP-22076m-PEG6-amineMolecular structure of the compound: m-PEG6-amine295.498%Pricing
BP-22077m-PEG7-amineMolecular structure of the compound: m-PEG7-amine339.498%Pricing
BP-21111m-PEG8-amineMolecular structure of the compound: m-PEG8-amine383.598%Pricing
BP-22078m-PEG9-amineMolecular structure of the compound: m-PEG9-amine427.598%Pricing
BP-22079m-PEG10-amineMolecular structure of the compound: m-PEG10-amine471.698%Pricing
BP-22080m-PEG11-amineMolecular structure of the compound: m-PEG11-amine515.698%Pricing
BP-21112m-PEG12-amineMolecular structure of the compound: m-PEG12-amine559.798%Pricing
BP-21907m-PEG15-amineMolecular structure of the compound: m-PEG15-amine691.998%Pricing
BP-21908m-PEG24-amineMolecular structure of the compound: m-PEG24-amine1088.397%Pricing
BP-21909m-PEG36-amineMolecular structure of the compound: m-PEG36-amine1617.092%Pricing
BP-22583m-PEG48-amineMolecular structure of the compound: m-PEG48-amine2145.697%Pricing
Propargyl-PEG-amine
BP-22519Propargyl-PEG2-amineMolecular structure of the compound: Propargyl-PEG2-amine143.298%Pricing
BP-21683Propargyl-PEG3-amineMolecular structure of the compound: Propargyl-PEG3-amine187.298%Pricing
BP-22520Propargyl-PEG4-amineMolecular structure of the compound: Propargyl-PEG4-amine231.398%Pricing
BP-22103Propargyl-PEG5-amineMolecular structure of the compound: Propargyl-PEG5-amine275.398%Pricing
BP-22876Propargyl-PEG6-amineMolecular structure of the compound: Propargyl-PEG6-amine319.498%Pricing
BP-22521Propargyl-PEG8-amineMolecular structure of the compound: Propargyl-PEG8-amine407.598%Pricing
BP-23419Propargyl-PEG9-amineMolecular structure of the compound: Propargyl-PEG9-amine451.695%Pricing
BP-23637Propargyl-PEG10-amineMolecular structure of the compound: Propargyl-PEG10-amine495.698%Pricing
BP-23543Propargyl-PEG12-amineMolecular structure of the compound: Propargyl-PEG12-amine583.798%Pricing
BP-23544Propargyl-PEG24-amineMolecular structure of the compound: Propargyl-PEG24-amine1112.498%Pricing
t-Boc-N-Amido-PEG-amine
BP-22862t-Boc-N-amido-PEG1-amineMolecular structure of the compound: t-Boc-N-amido-PEG1-amine204.398%Pricing
BP-20301t-Boc-N-amido-PEG2-amineMolecular structure of the compound: t-Boc-N-amido-PEG2-amine248.398%Pricing
BP-20583t-Boc-N-Amido-PEG3-amineMolecular structure of the compound: t-Boc-N-Amido-PEG3-amine292.498%Pricing
BP-22602t-Boc-N-amido-PEG4-amineMolecular structure of the compound: t-Boc-N-amido-PEG4-amine336.498%Pricing
BP-20592t-boc-N-amido-PEG5-amineMolecular structure of the compound: t-boc-N-amido-PEG5-amine380.598%Pricing
BP-22603t-Boc-N-amido-PEG6-amineMolecular structure of the compound: t-Boc-N-amido-PEG6-amine424.598%Pricing
BP-22320t-boc-N-amido-PEG7-amineMolecular structure of the compound: t-boc-N-amido-PEG7-amine468.698%Pricing
BP-26111t-boc-N-amido-PEG8-amineMolecular structure of the compound: t-boc-N-amido-PEG8-amine512.698%Pricing
BP-22604t-Boc-N-amido-PEG9-amineMolecular structure of the compound: t-Boc-N-amido-PEG9-amine556.798%Pricing
BP-25631t-Boc-N-amido-PEG10-amineMolecular structure of the compound: t-Boc-N-amido-PEG10-amine600.898%Pricing
BP-21614t-Boc-N-amido-PEG11-amineMolecular structure of the compound: t-Boc-N-amido-PEG11-amine644.898%Pricing
BP-27874Boc-N-amido-PEG12-amineMolecular structure of the compound: Boc-N-amido-PEG12-amine688.998%Pricing
BP-22605t-Boc-N-amido-PEG15-amineMolecular structure of the compound: t-Boc-N-amido-PEG15-amine821.098%Pricing
BP-22606t-Boc-N-amido-PEG23-amineMolecular structure of the compound: t-Boc-N-amido-PEG23-amine1173.595%Pricing
BP-25461Boc-DODAMolecular structure of the compound: Boc-DODA276.4Pricing
BP-25466Boc-TOTAMolecular structure of the compound: Boc-TOTA320.4Pricing
BP-23744Boc-Gly-amido-(CH2)3-PEG3-(CH2)3-amineMolecular structure of the compound: Boc-Gly-amido-(CH2)3-PEG3-(CH2)3-amine377.598%Pricing
Cbz-N-amido-PEG-amine
BP-28401CbzNH-PEG3-CH2CH2NH2Molecular structure of the compound: CbzNH-PEG3-CH2CH2NH2326.4Pricing
BP-23502Cbz-N-amido-PEG15-amineMolecular structure of the compound: Cbz-N-amido-PEG15-amine855.098%Pricing
Benzyl-PEG-amine
BP-311942-(Benzyloxy)-1-ethanamineMolecular structure of the compound: 2-(Benzyloxy)-1-ethanamine151.2Pricing
Amino-PEG-benzyl ester
BP-24213Amino-PEG4-benzyl esterMolecular structure of the compound: Amino-PEG4-benzyl ester355.498%Pricing
D-Amino-PEG-Thalidomide
BP-24115D-Amino-PEG6-Thalidomide TFA saltMolecular structure of the compound: D-Amino-PEG6-Thalidomide TFA salt565.698%Pricing
DOTA-PEG-amine
BP-24067DOTA-PEG5-amine HCl saltMolecular structure of the compound: DOTA-PEG5-amine HCl salt666.898%Pricing
NH2-PEG-Glu-NH-m-PEG
BP-22744NH2-PEG4-Glu(OH)-NH-m-PEG24Molecular structure of the compound: NH2-PEG4-Glu(OH)-NH-m-PEG241464.898%Pricing
NH2-PEG-Lys-NH-m-PEG
BP-22745NH2-PEG4-Lys(t-Boc)-NH-m-PEG24Molecular structure of the compound: NH2-PEG4-Lys(t-Boc)-NH-m-PEG241563.998%Pricing
Trifluoroethyl-PEG-Amine
BP-231231,1,1-Trifluoroethyl-PEG4-amineMolecular structure of the compound: 1,1,1-Trifluoroethyl-PEG4-amine275.398%Pricing
Gly-PEG-amine
BP-23749Gly-PEG3-amine, TFA saltMolecular structure of the compound: Gly-PEG3-amine, TFA salt277.498%Pricing
Amine Branched PEG
BP-235992-Amino-1,3-bis(carboxylethoxy)propane HCl saltMolecular structure of the compound: 2-Amino-1,3-bis(carboxylethoxy)propane HCl salt235.298%Pricing
BP-23263N-(Amino-PEG3)-N-bis(PEG3-acid) HCl saltMolecular structure of the compound: N-(Amino-PEG3)-N-bis(PEG3-acid) HCl salt600.797%Pricing
BP-23480N-(Amino-PEG5)-N-bis(PEG4-acid)Molecular structure of the compound: N-(Amino-PEG5)-N-bis(PEG4-acid)776.998%Pricing
BP-23868N-(acid-PEG3)-N-bis(PEG3-amine)Molecular structure of the compound: N-(acid-PEG3)-N-bis(PEG3-amine)571.798%Pricing
BP-23953N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acid581.798%Pricing
BP-27889N-(Amino-PEG4)-N-Fluorescein-PEG4-acidMolecular structure of the compound: N-(Amino-PEG4)-N-Fluorescein-PEG4-acid874.0Pricing
BP-23952Amino-Tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Amino-Tri-(carboxyethoxymethyl)-methane337.398%Pricing
BP-25617Amine-PEG4-Amido-tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Amine-PEG4-Amido-tri-(carboxyethoxymethyl)-methane584.698%Pricing
BP-24369N-(Amino-PEG2)-N-bis(PEG3-azide)Molecular structure of the compound: N-(Amino-PEG2)-N-bis(PEG3-azide)550.798%Pricing
BP-24491N-(amine-PEG23)-N-bis(PEG3-azide) TFA saltMolecular structure of the compound: N-(amine-PEG23)-N-bis(PEG3-azide) TFA salt1703.898%Pricing
BP-25640N-(Amino-PEG10)-N-bis(PEG10-azide)Molecular structure of the compound: N-(Amino-PEG10)-N-bis(PEG10-azide)1519.897%Pricing
BP-25695N-(Amino-PEG23)-N-bis(PEG23-Azide)Molecular structure of the compound: N-(Amino-PEG23)-N-bis(PEG23-Azide)3237.998%Pricing
BP-27837Amine-Tri(3-methoxypropanamide-PEG23-Azide) Methane HCl saltMolecular structure of the compound: Amine-Tri(3-methoxypropanamide-PEG23-Azide) Methane HCl salt3617.798%Pricing
BP-23803N-(Azido-PEG4)-N-bis(PEG4-amine)Molecular structure of the compound: N-(Azido-PEG4)-N-bis(PEG4-amine)700.998%Pricing
BP-23580N-(Amino-PEG1)-N-bis(PEG2-propargyl) HCl saltMolecular structure of the compound: N-(Amino-PEG1)-N-bis(PEG2-propargyl) HCl salt356.598%Pricing
BP-23174N-(Mal-PEG6)-N-bis(PEG3-amine) TFA saltMolecular structure of the compound: N-(Mal-PEG6)-N-bis(PEG3-amine) TFA salt854.098%Pricing
BP-22367Tri(Amino-PEG3-amide)-amine TFA saltMolecular structure of the compound: Tri(Amino-PEG3-amide)-amine TFA salt756.098%Pricing
BP-22368Tri(Amino-PEG4-amide)-amine TFA saltMolecular structure of the compound: Tri(Amino-PEG4-amide)-amine TFA salt888.198%Pricing
BP-22369Tri(Amino-PEG5-amide)-amineMolecular structure of the compound: Tri(Amino-PEG5-amide)-amine1020.398%Pricing
BP-244202-Amino-1,3-bis(t-butoxycarbonylethoxy)propaneMolecular structure of the compound: 2-Amino-1,3-bis(t-butoxycarbonylethoxy)propane347.598%Pricing
BP-23266N-(Amino-PEG3)-N-bis(PEG3-t-butyl)Molecular structure of the compound: N-(Amino-PEG3)-N-bis(PEG3-t-butyl)712.997%Pricing
BP-24287N-(Amino-PEG3)-N-bis(PEG4-t-butyl ester)Molecular structure of the compound: N-(Amino-PEG3)-N-bis(PEG4-t-butyl ester)801.098%Pricing
BP-23525N-(Amino-PEG4)-N-bis(PEG4-t-butyl ester)Molecular structure of the compound: N-(Amino-PEG4)-N-bis(PEG4-t-butyl ester)845.198%Pricing
BP-23836N-(t-butyl ester-PEG3)-N-bis(PEG3-amine)Molecular structure of the compound: N-(t-butyl ester-PEG3)-N-bis(PEG3-amine)627.898%Pricing
BP-27956N-(t-butyl ester-PEG3)-N-bis(PEG3-amine)Molecular structure of the compound: N-(t-butyl ester-PEG3)-N-bis(PEG3-amine)655.897%Pricing
BP-23233NH-bis(PEG2-t-butyl ester)Molecular structure of the compound: NH-bis(PEG2-t-butyl ester)449.698%Pricing
BP-23234NH-bis(PEG3-t-butyl ester)Molecular structure of the compound: NH-bis(PEG3-t-butyl ester)537.798%Pricing
BP-23253NH-bis(PEG4-t-butyl ester)Molecular structure of the compound: NH-bis(PEG4-t-butyl ester)625.898%Pricing
BP-20943Amino-Tri-(t-butoxycarbonylethoxymethyl)-methaneMolecular structure of the compound: Amino-Tri-(t-butoxycarbonylethoxymethyl)-methane505.796%Pricing
BP-23631N-(Boc-PEG4)-NH-PEG4-t-butyl esterMolecular structure of the compound: N-(Boc-PEG4)-NH-PEG4-t-butyl ester640.898%Pricing
BP-23773NH-bis(PEG2-Boc)Molecular structure of the compound: NH-bis(PEG2-Boc)479.698%Pricing
BP-23225NH-bis(PEG3-Boc)Molecular structure of the compound: NH-bis(PEG3-Boc)567.798%Pricing
BP-23782NH-bis(PEG4-Boc)Molecular structure of the compound: NH-bis(PEG4-Boc)655.898%Pricing
BP-24404Amino-Tri-(m-PEG4-ethoxymethyl)-methaneMolecular structure of the compound: Amino-Tri-(m-PEG4-ethoxymethyl)-methane905.198%Pricing
BP-25511Amino-Tri-(Azide-PEG4-ethoxymethyl)-methaneMolecular structure of the compound: Amino-Tri-(Azide-PEG4-ethoxymethyl)-methane1070.298%Pricing
BP-25662Amino-Tri-(Azide-PEG10-ethoxymethyl)-methane HCl SaltMolecular structure of the compound: Amino-Tri-(Azide-PEG10-ethoxymethyl)-methane HCl Salt1863.298%Pricing
BP-27837Amine-Tri(3-methoxypropanamide-PEG23-Azide) Methane HCl saltMolecular structure of the compound: Amine-Tri(3-methoxypropanamide-PEG23-Azide) Methane HCl salt3617.798%Pricing
BP-25664(Amino-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methane HCl SaltMolecular structure of the compound: (Amino-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methane HCl Salt2374.898%Pricing
BP-22160NH-bis(m-PEG4)Molecular structure of the compound: NH-bis(m-PEG4)397.598%Pricing
BP-22161NH-bis(m-PEG8)Molecular structure of the compound: NH-bis(m-PEG8)749.998%Pricing
BP-209642-Amino-1,3-bis(tert-butyldimethylsilanoxy)propaneMolecular structure of the compound: 2-Amino-1,3-bis(tert-butyldimethylsilanoxy)propane319.696%Pricing
BP-20912Tris (O-TBDMS)3Molecular structure of the compound: Tris (O-TBDMS)3463.996%Pricing
BP-21543Diethyl 4-aminoheptanedioate HCl saltMolecular structure of the compound: Diethyl 4-aminoheptanedioate HCl salt231.397%Pricing