Aliphatic Linkers

Aliphatic Linkers


Aliphatic linkers are a subclass of hydrophobic PROTAC linkers that connect functional motifs within a PROTAC molecule. The functional groups constituting these linkers are amines, carboxylic acids, NHS esters, azides, alkynes, and strained cyclooctynes such as BCN and DBCO.

Catalog Product Name Structure M.W. Purity Pricing
Amino-aliphatic-acid
BP-282379-Aminononanoic acidMolecular structure of the compound: 9-Aminononanoic acid173.3Pricing
BP-2823610-Aminodecanoic acidMolecular structure of the compound: 10-Aminodecanoic acid187.3Pricing
BP-28235Aminoundecanoic acidMolecular structure of the compound: Aminoundecanoic acid201.3Pricing
BP-2823412-Aminododecanoic acidMolecular structure of the compound: 12-Aminododecanoic acid215.3Pricing
BP-2823315-Aminopentadecanoic AcidMolecular structure of the compound: 15-Aminopentadecanoic Acid257.4Pricing
BP-2823216-Aminohexadecanoic acidMolecular structure of the compound: 16-Aminohexadecanoic acid271.4Pricing
Amino-aliphatic-amine
BP-262771,3-DiaminopropaneMolecular structure of the compound: 1,3-Diaminopropane74.1Pricing
BP-41424Spermine, HCl saltMolecular structure of the compound: Spermine, HCl salt202.3Pricing
BP-405443,3'-(Propylimino)bis[N-(2-aminoethyl)propanamide]Molecular structure of the compound: 3,3-(Propylimino)bis[N-(2-aminoethyl)propanamide]287.498%Pricing
BP-420043,3'-((2-hydroxyethyl)azanediyl)bis(N-(3-aminopropyl)propanamide)Molecular structure of the compound: 3,3-((2-hydroxyethyl)azanediyl)bis(N-(3-aminopropyl)propanamide)317.4TechPricing
Amino-aliphatic-aminooxy
BP-25154t-Boc-Aminooxy-pentane-amineMolecular structure of the compound: t-Boc-Aminooxy-pentane-amine218.398%Pricing
Amino-aliphatic-azide
BP-251233-azidopropan-1-amineMolecular structure of the compound: 3-azidopropan-1-amine100.1Pricing
BP-296734-Azidobutan-1-amineMolecular structure of the compound: 4-Azidobutan-1-amine114.2Pricing
BP-251575-azidopentan-1-amineMolecular structure of the compound: 5-azidopentan-1-amine128.298%Pricing
BP-239656-AZIDOHEXAN-1-AMINEMolecular structure of the compound: 6-AZIDOHEXAN-1-AMINE142.295%Pricing
Amino-aliphatic-t-Boc
BP-31035N-Boc-EthylenediamineMolecular structure of the compound: N-Boc-Ethylenediamine160.2Pricing
BP-31125tert-Butyl (3-aminopropyl)carbamateMolecular structure of the compound: tert-Butyl (3-aminopropyl)carbamate174.2Pricing
BP-28264tert-Butyl (5-aminopentyl)carbamateMolecular structure of the compound: tert-Butyl (5-aminopentyl)carbamate202.3Pricing
BP-28263tert-Butyl (7-aminoheptyl)carbamateMolecular structure of the compound: tert-Butyl (7-aminoheptyl)carbamate230.4Pricing
BP-28262tert-butyl (8-aminooctyl)carbamateMolecular structure of the compound: tert-butyl (8-aminooctyl)carbamate244.4Pricing
BP-28261tert-Butyl (9-aminononyl)carbamateMolecular structure of the compound: tert-Butyl (9-aminononyl)carbamate258.4Pricing
BP-28260tert-Butyl (10-aminodecyl)carbamateMolecular structure of the compound: tert-Butyl (10-aminodecyl)carbamate272.4Pricing
BP-28259tert-Butyl (11-aminoundecyl)carbamateMolecular structure of the compound: tert-Butyl (11-aminoundecyl)carbamate286.5Pricing
BP-28258tert-Butyl (12-aminododecyl)carbamateMolecular structure of the compound: tert-Butyl (12-aminododecyl)carbamate300.5Pricing
BP-14159tert-Butyl 6-aminohexanoateMolecular structure of the compound: tert-Butyl 6-aminohexanoate187.397%Pricing
Amino-aliphatic-alcohol
BP-31055EthanolamineMolecular structure of the compound: Ethanolamine61.1Pricing
BP-310413-Amino-1-propanolMolecular structure of the compound: 3-Amino-1-propanol75.1Pricing
BP-254785-Amino-1-pentanolMolecular structure of the compound: 5-Amino-1-pentanol103.2Pricing
BP-311696-Amino-1-hexanolMolecular structure of the compound: 6-Amino-1-hexanol117.2Pricing
Bis-aliphatic-acid
BP-21128SUCCINIC ACIDMolecular structure of the compound: SUCCINIC ACID118.199%Pricing
BP-21143GLUTARIC ACIDMolecular structure of the compound: GLUTARIC ACID132.199%Pricing
BP-30248Adipic acidMolecular structure of the compound: Adipic acid146.195%Pricing
BP-21136PIMELIC ACIDMolecular structure of the compound: PIMELIC ACID160.298%Pricing
BP-27862Suberic acidMolecular structure of the compound: Suberic acid174.298%Pricing
BP-27863Azelaic acidMolecular structure of the compound: Azelaic acid188.298%Pricing
BP-27864Decanedioic acidMolecular structure of the compound: Decanedioic acid202.395%Pricing
BP-42538MEDICA16Molecular structure of the compound: MEDICA16342.5Pricing
BP-42544Bempedoic acidMolecular structure of the compound: Bempedoic acid344.5Pricing
BP-44072N-[{2-ethanol]amino]-bis-N-hexanoic acidMolecular structure of the compound: N-[{2-ethanol]amino]-bis-N-hexanoic acid289.495%Pricing
Bis-aliphatic-NHS ester
BP-22659DSG CrosslinkerMolecular structure of the compound: DSG Crosslinker326.397%Pricing
BP-22656DSS CrosslinkerMolecular structure of the compound: DSS Crosslinker368.397%Pricing
Acid-aliphatic-NHS ester
BP-14089Pentanedioic acidMolecular structure of the compound: Pentanedioic acid229.2Pricing
t-butyl-aliphatic-acid
BP-2439310-(tert-Butoxy)-10-oxodecanoic acidMolecular structure of the compound: 10-(tert-Butoxy)-10-oxodecanoic acid258.4Pricing
BP-24391tert-Butyl Hydrogen TetradecanedioateMolecular structure of the compound: tert-Butyl Hydrogen Tetradecanedioate314.595%Pricing
BP-2435418-(tert-Butoxy)-18-oxooctadecanoic acid)Molecular structure of the compound: 18-(tert-Butoxy)-18-oxooctadecanoic acid)370.6Pricing
BP-2799320-(tert-Butoxy)-20-oxoicosanoic acidMolecular structure of the compound: 20-(tert-Butoxy)-20-oxoicosanoic acid398.698%Pricing
t-butyl-aliphatic-NHS ester
BP-244056-(tert-Butoxy)-6-oxohexanoic NHS esterMolecular structure of the compound: 6-(tert-Butoxy)-6-oxohexanoic NHS ester299.395%Pricing
BP-2440610-(tert-Butoxy)-10-oxodecanoic NHS esterMolecular structure of the compound: 10-(tert-Butoxy)-10-oxodecanoic NHS ester355.498%Pricing
BP-24365t-butyl-octadecanedioate-NHS esterMolecular structure of the compound: t-butyl-octadecanedioate-NHS ester467.795%Pricing
t-butyl-aliphatic-Tos
BP-41740Tos-C16-t-butyl esterMolecular structure of the compound: Tos-C16-t-butyl ester482.795%Pricing
t-Boc-aliphatic-acid
BP-28247Boc-beta-Ala-OHMolecular structure of the compound: Boc-beta-Ala-OH189.2Pricing
BP-26122N-Boc-4-aminobutyric AcidMolecular structure of the compound: N-Boc-4-aminobutyric Acid203.298%Pricing
BP-28246Boc-5-aminopentanoic acidMolecular structure of the compound: Boc-5-aminopentanoic acid217.3Pricing
BP-28245Boc-6-aminohexanoic acidMolecular structure of the compound: Boc-6-aminohexanoic acid231.3Pricing
BP-28244Boc-7-Aminoheptanoic acidMolecular structure of the compound: Boc-7-Aminoheptanoic acid245.3Pricing
BP-28243Boc-8-aoc-ohMolecular structure of the compound: Boc-8-aoc-oh259.3Pricing
BP-282429-(Boc-amino)nonanoic AcidMolecular structure of the compound: 9-(Boc-amino)nonanoic Acid273.4Pricing
BP-28241Boc-10-Aminodecanoic acidMolecular structure of the compound: Boc-10-Aminodecanoic acid287.4Pricing
BP-28240Boc-11-aminoundecanoic acidMolecular structure of the compound: Boc-11-aminoundecanoic acid301.4Pricing
BP-28239Boc-12-Ado-OHMolecular structure of the compound: Boc-12-Ado-OH315.5Pricing
BP-28238N-Boc-15-aminopentadecanoic acidMolecular structure of the compound: N-Boc-15-aminopentadecanoic acid357.5Pricing
BP-2978516-(tert-Butoxy)-16-oxohexadecanoic acidMolecular structure of the compound: 16-(tert-Butoxy)-16-oxohexadecanoic acid342.598%Pricing
t-Boc-aliphatic-NHS ester
BP-29301Boc-5-aminopentanoic NHS esterMolecular structure of the compound: Boc-5-aminopentanoic NHS ester314.398%Pricing
t-Boc-aliphatic-Mal
BP-20992tert-butyl 2-(2,5-dioxo-2H-pyrrol-1(5H)-yl)ethylcarbamateMolecular structure of the compound: tert-butyl 2-(2,5-dioxo-2H-pyrrol-1(5H)-yl)ethylcarbamate240.395%Pricing
BP-20987tert-butyl 6-(2,5-dioxo-2H-pyrrol-1(5H)-yl)hexylcarbamateMolecular structure of the compound: tert-butyl 6-(2,5-dioxo-2H-pyrrol-1(5H)-yl)hexylcarbamate296.496%Pricing
t-Boc-aliphatic-alcohol
BP-312123-(Boc-amino)-1-propanolMolecular structure of the compound: 3-(Boc-amino)-1-propanol175.2Pricing
BP-254775-(Boc-amino)-1-pentanolMolecular structure of the compound: 5-(Boc-amino)-1-pentanol203.3Pricing
t-Boc-aliphatic-Tos
BP-283915-((tert-Butoxycarbonyl)amino)pentyl 4-methylbenzenesulfonateMolecular structure of the compound: 5-((tert-Butoxycarbonyl)amino)pentyl 4-methylbenzenesulfonate357.5Pricing
BP-284036-((tert-Butoxycarbonyl)amino)hexyl 4-methylbenzenesulfonateMolecular structure of the compound: 6-((tert-Butoxycarbonyl)amino)hexyl 4-methylbenzenesulfonate371.5Pricing
t-Boc-aliphatic-t-Boc
BP-44068Hydroxy-amino-bis(hexanoic acid)Molecular structure of the compound: Hydroxy-amino-bis(hexanoic acid)401.698%Pricing
Fmoc-aliphatic-acid
BP-41028Fmoc-Gly-OHMolecular structure of the compound: Fmoc-Gly-OH297.3Pricing
BP-28256Fmoc-4-aminobutanoic acidMolecular structure of the compound: Fmoc-4-aminobutanoic acid325.4Pricing
BP-28255Fmoc-5-aminopentanoic acidMolecular structure of the compound: Fmoc-5-aminopentanoic acid339.4Pricing
BP-28254Fmoc-6-aminohexanoic acidMolecular structure of the compound: Fmoc-6-aminohexanoic acid353.4Pricing
BP-28253Fmoc-7-amino-heptanoic acidMolecular structure of the compound: Fmoc-7-amino-heptanoic acid367.4Pricing
BP-28252N-Fmoc-8-aminooctanoic acidMolecular structure of the compound: N-Fmoc-8-aminooctanoic acid381.5Pricing
BP-28251Fmoc-9-aminononanoic acidMolecular structure of the compound: Fmoc-9-aminononanoic acid395.5Pricing
BP-44407Fmoc-10-aminononanoic acidMolecular structure of the compound: Fmoc-10-aminononanoic acid409.5Pricing
BP-28250Fmoc-11-aminoundecanoic acidMolecular structure of the compound: Fmoc-11-aminoundecanoic acid423.6Pricing
BP-28249Fmoc-12-aminododecanoic acidMolecular structure of the compound: Fmoc-12-aminododecanoic acid437.6Pricing
BP-2824814-(Fmoc-amino)-tetradecanoic acidMolecular structure of the compound: 14-(Fmoc-amino)-tetradecanoic acid465.6Pricing
BP-44408Fmoc-16-aminononanoic acidMolecular structure of the compound: Fmoc-16-aminononanoic acid493.7Pricing
BP-444096-(N-Fmoc-N-methyl-amino)hexanoic acidMolecular structure of the compound: 6-(N-Fmoc-N-methyl-amino)hexanoic acid367.4Pricing
Mal-aliphatic-acid
BP-297862-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetic acidMolecular structure of the compound: 2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetic acid155.197%Pricing
BP-204523-Maleimidopropionic acidMolecular structure of the compound: 3-Maleimidopropionic acid169.198%Pricing
BP-219994-(2,5-dioxo-2H-pyrrol-1(5H)-yl)butanoic acidMolecular structure of the compound: 4-(2,5-dioxo-2H-pyrrol-1(5H)-yl)butanoic acid183.296%Pricing
BP-235455-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acidMolecular structure of the compound: 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acid197.298%Pricing
BP-204156-Maleimidocaproic acidMolecular structure of the compound: 6-Maleimidocaproic acid211.298%Pricing
Mal-aliphatic-NHS ester
BP-28415N-(alfa-Maleimidoacetoxy)succinimideMolecular structure of the compound: N-(alfa-Maleimidoacetoxy)succinimide252.295%Pricing
BP-205093-Maleimido-propionic NHS esterMolecular structure of the compound: 3-Maleimido-propionic NHS ester266.298%Pricing
BP-312322,5-Dioxopyrrolidin-1yl 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)butanoateMolecular structure of the compound: 2,5-Dioxopyrrolidin-1yl 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)butanoate280.2Pricing
BP-243605-Maleimido-pentanoic NHS esterMolecular structure of the compound: 5-Maleimido-pentanoic NHS ester294.398%Pricing
BP-204006-Maleimido-hexanoic NHS esterMolecular structure of the compound: 6-Maleimido-hexanoic NHS ester308.398%Pricing
BP-22646SMPH CrosslinkerMolecular structure of the compound: SMPH Crosslinker379.497%Pricing
Mal-aliphatic-PFP ester
BP-204166-Maleimidocaproic acid PFP esterMolecular structure of the compound: 6-Maleimidocaproic acid PFP ester377.396%Pricing
Mal-aliphatic-amine
BP-20991N-(2-Aminoethyl)maleimide TFA saltMolecular structure of the compound: N-(2-Aminoethyl)maleimide TFA salt140.195%Pricing
BP-20986Mal-C6-amine TFA saltMolecular structure of the compound: Mal-C6-amine TFA salt196.395%Pricing
Mal-aliphatic-alcohol
BP-263501-(2-hydroxymethyl)-1-H-pyrrole-2,5-dioneMolecular structure of the compound: 1-(2-hydroxymethyl)-1-H-pyrrole-2,5-dione141.1Pricing
Bis-aliphatic-maleimide
BP-430631,6-BismaleimidohexaneMolecular structure of the compound: 1,6-Bismaleimidohexane276.3Pricing
3,4-Dibromo-Mal-Acid
BP-435173,4-Dibromo-Mal-C6-AcidMolecular structure of the compound: 3,4-Dibromo-Mal-C6-Acid36995%Pricing
Propargyl-aliphatic-acid
BP-311685-Hexynoic acidMolecular structure of the compound: 5-Hexynoic acid98.1Pricing
BP-296836-Heptynoic acidMolecular structure of the compound: 6-Heptynoic acid126.2Pricing
BP-283858-NonynoicacidMolecular structure of the compound: 8-Nonynoicacid154.2Pricing
BP-23393Alkynyl Myristic AcidMolecular structure of the compound: Alkynyl Myristic Acid224.395%Pricing
BP-23392Alkynyl Palmitic AcidMolecular structure of the compound: Alkynyl Palmitic Acid252.495%Pricing
BP-23391Alkynyl Stearic AcidMolecular structure of the compound: Alkynyl Stearic Acid280.595%Pricing
Propargyl-aliphatic-NHS ester
BP-284204-Pentynoic acid succinimidyl esterMolecular structure of the compound: 4-Pentynoic acid succinimidyl ester195.2Pricing
BP-244615-Hexynoic Acid-NHS EsterMolecular structure of the compound: 5-Hexynoic Acid-NHS Ester209.298%Pricing
BP-283892,5-Dioxopyrrolidin-1-yl hept-6-ynoateMolecular structure of the compound: 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate223.2Pricing
Propargyl-aliphatic-STP ester
BP-28994Pentynoic acid STP esterMolecular structure of the compound: Pentynoic acid STP ester325.2Pricing
BP-28993Hexynoic acid STP esterMolecular structure of the compound: Hexynoic acid STP ester339.2Pricing
Propargyl-aliphatic-maleimide
BP-28991Alkyne maleimideMolecular structure of the compound: Alkyne maleimide234.3Pricing
Propargyl-aliphatic-bromide
BP-283888-Bromooct-1-yneMolecular structure of the compound: 8-Bromooct-1-yne189.1Pricing
Propargyl-aliphatic-Tos
BP-28386Hept-6-yn-1-yl 4-methylbenzenesulfonateMolecular structure of the compound: Hept-6-yn-1-yl 4-methylbenzenesulfonate266.4Pricing
Propargyl-aliphatic-t-Boc
BP-28405tert-Butyl oct-7-yn-1-ylcarbamateMolecular structure of the compound: tert-Butyl oct-7-yn-1-ylcarbamate225.3Pricing
Propargyl-aliphatic-alcohol
BP-310763-Butyn-1-olMolecular structure of the compound: 3-Butyn-1-ol70.1Pricing
BP-296667-Octyn-1-olMolecular structure of the compound: 7-Octyn-1-ol126.2Pricing
BP-140833-Decyn-1-olMolecular structure of the compound: 3-Decyn-1-ol154.3Pricing
Propargyl-aliphatic-hydrazide
BP-28990Alkyne hydrazideMolecular structure of the compound: Alkyne hydrazide127.2Pricing
Propargyl-aliphatic-isoindole-1,3-dione
BP-296612-(7-Octyn-1-yl)-1H-isoindole-1,3-dioneMolecular structure of the compound: 2-(7-Octyn-1-yl)-1H-isoindole-1,3-dione255.3Pricing
Azido-aliphatic-acid
BP-238762-Azidoacetic AcidMolecular structure of the compound: 2-Azidoacetic Acid101.197%Pricing
BP-237993-Azidopropionic AcidMolecular structure of the compound: 3-Azidopropionic Acid115.195%Pricing
BP-238754-azidobutyric acidMolecular structure of the compound: 4-azidobutyric acid129.198%Pricing
BP-310685-azidopentanoic acidMolecular structure of the compound: 5-azidopentanoic acid143.195%Pricing
BP-254466-Azido-hexanoic acidMolecular structure of the compound: 6-Azido-hexanoic acid157.297%Pricing
BP-2547011-Azidoundecanoic acidMolecular structure of the compound: 11-Azidoundecanoic acid227.3Pricing
BP-40287Azido Myristic AcidMolecular structure of the compound: Azido Myristic Acid241.3Pricing
BP-40288Azido Palmitic AcidMolecular structure of the compound: Azido Palmitic Acid283.4Pricing
Azido-aliphatic-NHS ester
BP-238003-Azidopropanoic acid NHS esterMolecular structure of the compound: 3-Azidopropanoic acid NHS ester212.298%Pricing
BP-22526Azidobutyric acid NHS esterMolecular structure of the compound: Azidobutyric acid NHS ester226.296%Pricing
BP-296945-Azidopentanoic acid N-hydroxysuccinimide esterMolecular structure of the compound: 5-Azidopentanoic acid N-hydroxysuccinimide ester240.2Pricing
BP-25454Azido-Aca-NHSMolecular structure of the compound: Azido-Aca-NHS254.297%Pricing
BP-254682,5-Dioxo-1-pyrrolidinyl 11-azidoundecanoateMolecular structure of the compound: 2,5-Dioxo-1-pyrrolidinyl 11-azidoundecanoate324.4Pricing
Azido-aliphatic-ethyl ester
BP-29695Ethyl 3-azidopropanoateMolecular structure of the compound: Ethyl 3-azidopropanoate143.1Pricing
BP-29696Ethyl 4-azidobutyrateMolecular structure of the compound: Ethyl 4-azidobutyrate157.2Pricing
BP-296935-Azidopentanoic acid ethyl esterMolecular structure of the compound: 5-Azidopentanoic acid ethyl ester171.2Pricing
BP-29697Ethyl 6-azidohexanoateMolecular structure of the compound: Ethyl 6-azidohexanoate185.2Pricing
t-Boc-aliphatic-azide
BP-29670tert-Butyl (3-azidopropyl)carbamateMolecular structure of the compound: tert-Butyl (3-azidopropyl)carbamate200.2Pricing
BP-29699tert-Butyl N-(4-azidobutyl)carbamateMolecular structure of the compound: tert-Butyl N-(4-azidobutyl)carbamate214.3Pricing
Azido-aliphatic-amiooxy
BP-25153t-Boc-Aminooxy-pentane-azideMolecular structure of the compound: t-Boc-Aminooxy-pentane-azide244.398%Pricing
Azido-aliphatic-azide
BP-251481,5-diazidopentaneMolecular structure of the compound: 1,5-diazidopentane154.295%Pricing
Azido-aliphatic-alcohol
BP-263513-Azido-alcoholMolecular structure of the compound: 3-Azido-alcohol101.195%Pricing
BP-296924-Azidobutan-1-olMolecular structure of the compound: 4-Azidobutan-1-ol115.1Pricing
BP-251495-azidopentan-1-olMolecular structure of the compound: 5-azidopentan-1-ol129.295%Pricing
BP-2968811-azido-1-undecanolMolecular structure of the compound: 11-azido-1-undecanol213.3Pricing
Azido-aliphatic-benzoate
BP-296744-Azidobutyl benzoateMolecular structure of the compound: 4-Azidobutyl benzoate219.2Pricing
Azido-aliphatic-methoxybenzene
BP-296861-((4-Azidobutoxy)methyl)-4-methoxybenzeneMolecular structure of the compound: 1-((4-Azidobutoxy)methyl)-4-methoxybenzene235.3Pricing
Azido-aliphatic-isoindoline-1,3-dione
BP-296592-(5-Azidopentyl)isoindoline-1,3-dioneMolecular structure of the compound: 2-(5-Azidopentyl)isoindoline-1,3-dione258.3Pricing
BP-296602-(6-Azidohexyl)isoindoline-1,3-dioneMolecular structure of the compound: 2-(6-Azidohexyl)isoindoline-1,3-dione272.3Pricing
Azido-aliphatic-tosyl
BP-25152Tos-pentane-azideMolecular structure of the compound: Tos-pentane-azide283.498%Pricing
Azido-aliphatic-t-butyldimethylsilane
BP-29685[(5-Azidopentyl)oxy](tert-butyl)dimethylsilaneMolecular structure of the compound: [(5-Azidopentyl)oxy](tert-butyl)dimethylsilane243.4Pricing
Azido-aliphatic-biotin
BP-296645-(Biotinamido)butyllazideMolecular structure of the compound: 5-(Biotinamido)butyllazide340.5Pricing
BP-296815-(Biotinamido)pentylazideMolecular structure of the compound: 5-(Biotinamido)pentylazide354.5Pricing
BP-296826-(Biotinamido)hexylazideMolecular structure of the compound: 6-(Biotinamido)hexylazide368.5Pricing
Azido-aliphatic-acetyl chloride
BP-296913-Azidopropanoyl chloride 10% in MTBEMolecular structure of the compound: 3-Azidopropanoyl chloride 10% in MTBE133.5Pricing
Azido-aliphatic-isoindole-1,3-dione
BP-296892-(3-azidopropyl)-isoindole-1,3-dioneMolecular structure of the compound: 2-(3-azidopropyl)-isoindole-1,3-dione230.2Pricing
BP-296902-(4-Azidobutyl)isoindoline-1,3-dioneMolecular structure of the compound: 2-(4-Azidobutyl)isoindoline-1,3-dione244.3Pricing
TPF-aliphatic-NHS ester
BP-42863ATFB SE (N-Succinimidyl 4-Azidotetrafluorobenzoate)Molecular structure of the compound: ATFB SE (N-Succinimidyl 4-Azidotetrafluorobenzoate)332.2Pricing
Bromo-aliphatic-acid
BP-311497-Bromoheptanoic acidMolecular structure of the compound: 7-Bromoheptanoic acid209.1Pricing
BP-310878-Bromooctanoic acidMolecular structure of the compound: 8-Bromooctanoic acid223.195%Pricing
BP-3114810-Bromodecanoic acidMolecular structure of the compound: 10-Bromodecanoic acid251.2Pricing
Bromo-PEG-Ester
BP-43310undecyl 3-(2-bromoethoxy)propanoateMolecular structure of the compound: undecyl 3-(2-bromoethoxy)propanoate351.3Pricing
Bromo-aliphatic-bromide
BP-311901,3-DibromopropaneMolecular structure of the compound: 1,3-Dibromopropane201.9Pricing
Bromo-aliphatic-alcohol
BP-311893-Bromo-1-propanolMolecular structure of the compound: 3-Bromo-1-propanol201.9Pricing
Bromo-aliphatic-acetyl chloride
BP-311748-bromooctanoyl chlorideMolecular structure of the compound: 8-bromooctanoyl chloride241.6Pricing
Thiol-aliphatic-NHS ester
BP-2965311-Mercaptoundecanoic acid 2,5-dioxo-1-pyrrolidinyl esterMolecular structure of the compound: 11-Mercaptoundecanoic acid 2,5-dioxo-1-pyrrolidinyl ester315.4Pricing
Hydroxy-aliphatic-Tos
BP-283926-Hydroxyhexyl 4-methylbenzenesulfonateMolecular structure of the compound: 6-Hydroxyhexyl 4-methylbenzenesulfonate272.4Pricing
t-butyl-aliphatic-alcohol
BP-278614-Hydroxy-butyric acid tert-butyl esterMolecular structure of the compound: 4-Hydroxy-butyric acid tert-butyl ester160.2Pricing
BP-28094tert-butyl 6-hydroxyhexanoateMolecular structure of the compound: tert-butyl 6-hydroxyhexanoate188.3Pricing
BP-28093tert-butyl 7-hydroxyheptanoateMolecular structure of the compound: tert-butyl 7-hydroxyheptanoate202.3Pricing
BP-41648tert-butyl 16-hydroxyhexadecanoateMolecular structure of the compound: tert-butyl 16-hydroxyhexadecanoate328.5Pricing
t-butyl-aliphatic-methyl ester
BP-29671tert-Butyl methyl adipateMolecular structure of the compound: tert-Butyl methyl adipate216.3Pricing
Iodoacetamide-aliphatic-azide
BP-28101Iodoacetamide AzideMolecular structure of the compound: Iodoacetamide Azide268.1Pricing
Hydroxyl-aliphatic-iodide
BP-296656-Iodohexan-1-olMolecular structure of the compound: 6-Iodohexan-1-ol228.1Pricing
BP-296678-Iodooct-7-yn-1-olMolecular structure of the compound: 8-Iodooct-7-yn-1-ol252.1Pricing
t-boc-aliphatic-iodide
BP-29680tert-Butyl 3-iodopropylcarbamateMolecular structure of the compound: tert-Butyl 3-iodopropylcarbamate285.1Pricing
BP-28393tert-Butyl (4-iodobutyl)carbamateMolecular structure of the compound: tert-Butyl (4-iodobutyl)carbamate299.2Pricing
BP-28398tert-Butyl (6-iodohexyl)carbamateMolecular structure of the compound: tert-Butyl (6-iodohexyl)carbamate327.2Pricing
Benzoate-aliphatic-iodide
BP-296634-Iodobutyl benzoateMolecular structure of the compound: 4-Iodobutyl benzoate304.1Pricing
t-butyldimethylsilane-aliphatic-iodide
BP-29684(1,1-Dimethylethyl)[(5-iodopentyl)oxy]dimethylsilaneMolecular structure of the compound: (1,1-Dimethylethyl)[(5-iodopentyl)oxy]dimethylsilane328.3Pricing
Chloro-aliphatic-iodide
BP-141611-Chloro-6-iodohexaneMolecular structure of the compound: 1-Chloro-6-iodohexane246.598%Pricing
t-boc-aliphatic-chloride
BP-29679tert-Butyl (3-chloropropyl)carbamateMolecular structure of the compound: tert-Butyl (3-chloropropyl)carbamate193.7Pricing
Chloro-aliphatic-silane
BP-296764-Chlorobutoxy(trimethyl)silaneMolecular structure of the compound: 4-Chlorobutoxy(trimethyl)silane180.8Pricing
Chloro-aliphatic-isoindole-1,3(2H)-dione
BP-296582-(3-Chloropropyl)-1H-isoindole-1,3(2H)-dioneMolecular structure of the compound: 2-(3-Chloropropyl)-1H-isoindole-1,3(2H)-dione223.7Pricing
Olumacostat glasaretil
BP-42545Olumacostat glasaretilMolecular structure of the compound: Olumacostat glasaretil481.6Pricing
Cbz-N-Amido-aliphatic-acid
BP-28400N-Cbz-7-aminoheptanoic acidMolecular structure of the compound: N-Cbz-7-aminoheptanoic acid279.3Pricing
Benzyloxy-aliphatic-aldehyde
BP-296754-BenzyloxybutanalMolecular structure of the compound: 4-Benzyloxybutanal178.2Pricing
Cbz-N-Amido-aliphatic-aldehyde
BP-28383Benzyl (6-oxohexyl)carbamateMolecular structure of the compound: Benzyl (6-oxohexyl)carbamate249.3Pricing
Cbz-N-Amido-aliphatic-bromide
BP-41015Phenylmethyl N-(8-bromooctyl)carbamateMolecular structure of the compound: Phenylmethyl N-(8-bromooctyl)carbamate342.398%Pricing
BP-41014Phenylmethyl N-(10-bromodecyl)carbamateMolecular structure of the compound: Phenylmethyl N-(10-bromodecyl)carbamate370.398%Pricing
Cbz-N-Amido-aliphatic-alcohol
BP-28384Benzyl (5-hydroxypentyl)carbamateMolecular structure of the compound: Benzyl (5-hydroxypentyl)carbamate237.3Pricing
BP-41002Phenylmethyl N-(8-hydroxyoctyl)carbamateMolecular structure of the compound: Phenylmethyl N-(8-hydroxyoctyl)carbamate279.4Pricing
Hydroxyl-aliphatic-methoxyphenyl
BP-296724-[(4-Methoxyphenyl)methoxy]butan-1-olMolecular structure of the compound: 4-[(4-Methoxyphenyl)methoxy]butan-1-ol210.3Pricing
Piperidinepentanoic acid
BP-407171-Piperidinepentanoic acidMolecular structure of the compound: 1-Piperidinepentanoic acid185.398%Pricing
Morpholinepentanoic acid
BP-407184-Morpholinepentanoic acidMolecular structure of the compound: 4-Morpholinepentanoic acid187.298%Pricing
RV 538
BP-42533RV 538Molecular structure of the compound: RV 538390.6Pricing
Piperazinepentanoic acid
BP-407194-Methyl-1-piperazinepentanoic acidMolecular structure of the compound: 4-Methyl-1-piperazinepentanoic acid200.398%Pricing
BP-422964-(4-(2-hydroxyethyl)piperazin-1-yl)butanoic acidMolecular structure of the compound: 4-(4-(2-hydroxyethyl)piperazin-1-yl)butanoic acid216.398%Pricing
Piperazinepentanoic methyl ester
BP-41478methyl 5-(4-methylpiperazin-1-yl)pentanoateMolecular structure of the compound: methyl 5-(4-methylpiperazin-1-yl)pentanoate214.395%Pricing
N-aliphatic-5-(dimethylamino)naphthalene-1-sulfonamide
BP-40060N-butyl-5-(dimethylamino)naphthalene-1-sulfonamideMolecular structure of the compound: N-butyl-5-(dimethylamino)naphthalene-1-sulfonamide306.495%Pricing
BP-24208MDHMolecular structure of the compound: MDH320.5Pricing